fireworks627
fireworks627 fireworks627
  • 16-03-2017
  • History
contestada

When words needed to be spoken, how was this done in silent movies

Respuesta :

jonathancast46 jonathancast46
  • 16-03-2017
They put a black screen with writen words they were saying 
Answer Link

Otras preguntas

Given the function f(x)=-3x^3+9x^2-2x+3 what part of the function indicates that the left end starts at the top of the graph
f(x)=x+7 and , g(x)=1/x-13 what is the domain of (f*g) (x) P L E A S E H E L P A S A P !
Line division question, pretty certain on the first answer but cant get the right one to the second drop down
Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(
Is the equation y=85x-600 linear? Explain why or why not.
If you drew a cartogram emphasizing areas of high population density, what areas of the world would show up the largest?
HELP fast please!!!!! Classify the sequence as arithmetic, geometric, or neither. If there is not enough information to classify the sequence, choose not enough
bobby earns $5 for every car he washes, which graph shows the amount Bobby will earn if he washes c cars
how did hobbes and rousseau differ
WHAT DOES THE WORD MONOCHROME MEAN?