yaribelthomas2185 yaribelthomas2185

17-12-2019
Geography

contestada

What landforms are shared by the united states and canada

Respuesta :

nevabbx nevabbx

17-12-2019

Answer:

A few examples include the Appalachian Mountains, Rocky Mountains as well as the Great Plains.

Answer Link

Otras preguntas

bertha's friends recently started drinking she goes to a lot of parties with them where she is always pressured by the others to have a drink which is the best

Data that is so large and complex that it cannot be processed using conventional methods is called

How likely is it for someone to loose egg roulette?

Create an outline of your paragraph about your participation in the economy this week. describe how you were a consumer or producer, and any economic decisions

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

Solve each inequality 1) Y/2>0 2) -4< r/ 3) 5c< 10

____ advanced Mesopotamian civilization by combining laws from many cultures and reinforcing the idea that government has responsibility to the citizens.

why were merchants considered the lowest class even though the song dynasty grew wealthy through trade

Read the following excerpt from Hamlet: Act II, scene 2 GUILDENSTERN Prison, my lord? HAMLET Denmark’s a prison. ROSENCRANTZ Then is the world one. HAMLET

which mathematical property is demonstrated 7 + 9 + 3 = 7 + 3 + 9