natclrk187 natclrk187

17-05-2023
Mathematics

contestada

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:

cos(A-B)=cosACosB+sinAsinB

find cos(A-B)

Let sin A 13 where A terminates in Quadrant 1 and let cos B 23 where B terminates in Quadrant 4 Using the identity cosABcosACosBsinAsinB find cosAB class=

Respuesta :

Otras preguntas

If M Need help asap ...................

simplify 7(a²)³ x 8a⁵ / 4a⁷ and explain

How do i complete highschool

given m||n find the value of x

Write the two sentences "It's one o'clock." and "It's three o'clock." in Spanish. I

Hey guys answer for points! Question: 7 = x + 2x - 5 - 5x Please include your steps and make sure it is accurate! Brainiest for correct answer/good answer!

How is the next term in this sequence found? −6, −4, −2, 0, 2 A) A) Add 2 to the previous term. B) Add −2 to the previous term. C) Multiply the previous term b

which of the following answers is true about the structure of an atom 1. neutrons and electrons make up the nucleus of an atom 2. electrons are found in outer o

¿Cuáles son los rasgos sobresalientes de los géneros literarios (teatro, poesía, cuento, ensayo y oratoria)?

Which of the following events were considered the most deadly terrorist attacks of the 1990s?